C32H39N5O4 — CID 23846488
(3R)-1-benzyl-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxoazocan-1-yl)indol-2-one (PubChem CID 23846488) has the molecular formula C32H39N5O4 and a molecular weight of 557.70 g/mol. Its IUPAC name is (3R)-1-benzyl-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxoazocan-1-yl)indol-2-one.
| Compound Name | (3R)-1-benzyl-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxoazocan-1-yl)indol-2-one |
|---|---|
| PubChem CID | 23846488 |
| Molecular Formula | C32H39N5O4 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | (3R)-1-benzyl-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxoazocan-1-yl)indol-2-one |
| SMILES | C[C@@H](/C=C/CCn1cc(CCO)nn1)[C@]1(O)C(=O)N(Cc2ccccc2)c2ccc(N3CCCCCCC3=O)cc21 |
| InChI | InChI=1S/C32H39N5O4/c1-24(11-8-10-18-35-23-26(17-20-38)33-34-35)32(41)28-21-27(36-19-9-3-2-7-14-30(36)39)15-16-29(28)37(31(32)40)22-25-12-5-4-6-13-25/h4-6,8,11-13,15-16,21,23-24,38,41H,2-3,7,9-10,14,17-20,22H2,1H3/b11-8+/t24-,32+/m0/s1 |
| InChIKey | MRDPQLZNYXJFFT-JWTQJLJXSA-N |
| XLogP | 4.13 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|