C31H37N5O4 — CID 23874150
(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxoazocan-1-yl)-1-phenylindol-2-one (PubChem CID 23874150) has the molecular formula C31H37N5O4 and a molecular weight of 543.67 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxoazocan-1-yl)-1-phenylindol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxoazocan-1-yl)-1-phenylindol-2-one |
|---|---|
| PubChem CID | 23874150 |
| Molecular Formula | C31H37N5O4 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxoazocan-1-yl)-1-phenylindol-2-one |
| SMILES | C[C@H](/C=C/CCn1cc(CCO)nn1)[C@@]1(O)C(=O)N(c2ccccc2)c2ccc(N3CCCCCCC3=O)cc21 |
| InChI | InChI=1S/C31H37N5O4/c1-23(11-8-10-18-34-22-24(17-20-37)32-33-34)31(40)27-21-26(35-19-9-3-2-7-14-29(35)38)15-16-28(27)36(30(31)39)25-12-5-4-6-13-25/h4-6,8,11-13,15-16,21-23,37,40H,2-3,7,9-10,14,17-20H2,1H3/b11-8+/t23-,31+/m1/s1 |
| InChIKey | LLMIFTXUEAQSBJ-QWJQSQHYSA-N |
| XLogP | 4.26 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|