C29H39N5O6 — CID 23817592
methyl 5-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(2-oxopiperidin-1-yl)indol-1-yl]pentanoate (PubChem CID 23817592) has the molecular formula C29H39N5O6 and a molecular weight of 553.66 g/mol. Its IUPAC name is methyl 5-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(2-oxopiperidin-1-yl)indol-1-yl]pentanoate.
| Compound Name | methyl 5-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(2-oxopiperidin-1-yl)indol-1-yl]pentanoate |
|---|---|
| PubChem CID | 23817592 |
| Molecular Formula | C29H39N5O6 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | methyl 5-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(2-oxopiperidin-1-yl)indol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@](O)([C@H](C)/C=C/CCn2cc(CCO)nn2)c2cc(N3CCCCC3=O)ccc21 |
| InChI | InChI=1S/C29H39N5O6/c1-21(9-3-6-15-32-20-22(14-18-35)30-31-32)29(39)24-19-23(33-16-7-4-10-26(33)36)12-13-25(24)34(28(29)38)17-8-5-11-27(37)40-2/h3,9,12-13,19-21,35,39H,4-8,10-11,14-18H2,1-2H3/b9-3+/t21-,29+/m1/s1 |
| InChIKey | WZPZPMCYFPOIJL-DLRRMLFUSA-N |
| XLogP | 2.49 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|