C32H37N5O7 — CID 23759759
methyl 5-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)indol-1-yl]pentanoate (PubChem CID 23759759) has the molecular formula C32H37N5O7 and a molecular weight of 603.68 g/mol. Its IUPAC name is methyl 5-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)indol-1-yl]pentanoate.
| Compound Name | methyl 5-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)indol-1-yl]pentanoate |
|---|---|
| PubChem CID | 23759759 |
| Molecular Formula | C32H37N5O7 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | methyl 5-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-5-(3-oxo-1,4-benzoxazin-4-yl)indol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@](O)([C@H](C)/C=C/CCn2cc(CCO)nn2)c2cc(N3C(=O)COc4ccccc43)ccc21 |
| InChI | InChI=1S/C32H37N5O7/c1-22(9-5-7-16-35-20-23(15-18-38)33-34-35)32(42)25-19-24(37-27-10-3-4-11-28(27)44-21-29(37)39)13-14-26(25)36(31(32)41)17-8-6-12-30(40)43-2/h3-5,9-11,13-14,19-20,22,38,42H,6-8,12,15-18,21H2,1-2H3/b9-5+/t22-,32+/m1/s1 |
| InChIKey | XKDLXGSVORJFCF-GAJMMUGDSA-N |
| XLogP | 3.03 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|