C37H41N5O6 — CID 23957765
methyl 5-[(3R)-5-(N-formylanilino)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate (PubChem CID 23957765) has the molecular formula C37H41N5O6 and a molecular weight of 651.76 g/mol. Its IUPAC name is methyl 5-[(3R)-5-(N-formylanilino)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate.
| Compound Name | methyl 5-[(3R)-5-(N-formylanilino)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate |
|---|---|
| PubChem CID | 23957765 |
| Molecular Formula | C37H41N5O6 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | methyl 5-[(3R)-5-(N-formylanilino)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@@](O)([C@@H](C)/C=C/CCn2cc(C(CO)c3ccccc3)nn2)c2cc(N(C=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C37H41N5O6/c1-27(13-9-11-21-40-24-33(38-39-40)31(25-43)28-14-5-3-6-15-28)37(47)32-23-30(42(26-44)29-16-7-4-8-17-29)19-20-34(32)41(36(37)46)22-12-10-18-35(45)48-2/h3-9,13-17,19-20,23-24,26-27,31,43,47H,10-12,18,21-22,25H2,1-2H3/b13-9+/t27-,31?,37+/m0/s1 |
| InChIKey | GMDDUEIKEGHAEE-APLOFCKVSA-N |
| XLogP | 4.86 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|