C25H27N5O5 — CID 23817602
(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-methyl-5-nitroindol-2-one (PubChem CID 23817602) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-methyl-5-nitroindol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-methyl-5-nitroindol-2-one |
|---|---|
| PubChem CID | 23817602 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-methyl-5-nitroindol-2-one |
| SMILES | C[C@H](/C=C/CCn1cc(C(CO)c2ccccc2)nn1)[C@@]1(O)C(=O)N(C)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C25H27N5O5/c1-17(25(33)21-14-19(30(34)35)11-12-23(21)28(2)24(25)32)8-6-7-13-29-15-22(26-27-29)20(16-31)18-9-4-3-5-10-18/h3-6,8-12,14-15,17,20,31,33H,7,13,16H2,1-2H3/b8-6+/t17-,20?,25+/m1/s1 |
| InChIKey | GHNUVFSPHGAPST-LBMVZWSZSA-N |
| XLogP | 2.76 |
| TPSA | 134.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|