C32H33N5O4 — CID 23817604
N-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-methyl-2-oxoindol-5-yl]-N-phenylformamide (PubChem CID 23817604) has the molecular formula C32H33N5O4 and a molecular weight of 551.65 g/mol. Its IUPAC name is N-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-methyl-2-oxoindol-5-yl]-N-phenylformamide.
| Compound Name | N-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-methyl-2-oxoindol-5-yl]-N-phenylformamide |
|---|---|
| PubChem CID | 23817604 |
| Molecular Formula | C32H33N5O4 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | N-[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-methyl-2-oxoindol-5-yl]-N-phenylformamide |
| SMILES | C[C@H](/C=C/CCn1cc(C(CO)c2ccccc2)nn1)[C@@]1(O)C(=O)N(C)c2ccc(N(C=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C32H33N5O4/c1-23(11-9-10-18-36-20-29(33-34-36)27(21-38)24-12-5-3-6-13-24)32(41)28-19-26(16-17-30(28)35(2)31(32)40)37(22-39)25-14-7-4-8-15-25/h3-9,11-17,19-20,22-23,27,38,41H,10,18,21H2,1-2H3/b11-9+/t23-,27?,32+/m1/s1 |
| InChIKey | PUAAXPGRAKQPBA-HXYJRCEGSA-N |
| XLogP | 4.14 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|