C31H30ClIN4O3 — CID 23902110
(3R)-5-chloro-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one (PubChem CID 23902110) has the molecular formula C31H30ClIN4O3 and a molecular weight of 668.96 g/mol. Its IUPAC name is (3R)-5-chloro-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one.
| Compound Name | (3R)-5-chloro-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one |
|---|---|
| PubChem CID | 23902110 |
| Molecular Formula | C31H30ClIN4O3 |
| Molecular Weight | 668.96 g/mol |
| Exact Mass | 668.11 |
| IUPAC Name | (3R)-5-chloro-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one |
| SMILES | C[C@@H](/C=C/CCn1cc(C(CO)c2ccccc2)nn1)[C@]1(O)C(=O)N(Cc2cccc(I)c2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C31H30ClIN4O3/c1-21(8-5-6-15-36-19-28(34-35-36)26(20-38)23-10-3-2-4-11-23)31(40)27-17-24(32)13-14-29(27)37(30(31)39)18-22-9-7-12-25(33)16-22/h2-5,7-14,16-17,19,21,26,38,40H,6,15,18,20H2,1H3/b8-5+/t21-,26?,31+/m0/s1 |
| InChIKey | JZZJEUWDHXDEQC-SDGSDGEASA-N |
| XLogP | 5.68 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.96 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|