C39H38N6O5 — CID 23817733
2-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-methoxy-2-oxoindol-1-yl]methyl]phenyl]-1H-indazol-3-one (PubChem CID 23817733) has the molecular formula C39H38N6O5 and a molecular weight of 670.77 g/mol. Its IUPAC name is 2-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-methoxy-2-oxoindol-1-yl]methyl]phenyl]-1H-indazol-3-one.
| Compound Name | 2-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-methoxy-2-oxoindol-1-yl]methyl]phenyl]-1H-indazol-3-one |
|---|---|
| PubChem CID | 23817733 |
| Molecular Formula | C39H38N6O5 |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | 2-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-methoxy-2-oxoindol-1-yl]methyl]phenyl]-1H-indazol-3-one |
| SMILES | COc1ccc2c(c1)[C@](O)([C@@H](C)/C=C/CCn1cc(C(CO)c3ccccc3)nn1)C(=O)N2Cc1cccc(-n2[nH]c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C39H38N6O5/c1-26(11-8-9-20-43-24-35(40-42-43)32(25-46)28-13-4-3-5-14-28)39(49)33-22-30(50-2)18-19-36(33)44(38(39)48)23-27-12-10-15-29(21-27)45-37(47)31-16-6-7-17-34(31)41-45/h3-8,10-19,21-22,24,26,32,41,46,49H,9,20,23,25H2,1-2H3/b11-8+/t26-,32?,39+/m0/s1 |
| InChIKey | SMQQSWDNCDJKDE-POZCCEIHSA-N |
| XLogP | 5.06 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|