C32H31BrN6O4 — CID 23958045
2-[3-[[(3S)-5-bromo-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]methyl]phenyl]-1H-indazol-3-one (PubChem CID 23958045) has the molecular formula C32H31BrN6O4 and a molecular weight of 643.54 g/mol. Its IUPAC name is 2-[3-[[(3S)-5-bromo-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]methyl]phenyl]-1H-indazol-3-one.
| Compound Name | 2-[3-[[(3S)-5-bromo-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]methyl]phenyl]-1H-indazol-3-one |
|---|---|
| PubChem CID | 23958045 |
| Molecular Formula | C32H31BrN6O4 |
| Molecular Weight | 643.54 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | 2-[3-[[(3S)-5-bromo-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]methyl]phenyl]-1H-indazol-3-one |
| SMILES | C[C@H](/C=C/CCn1cc(CCO)nn1)[C@@]1(O)C(=O)N(Cc2cccc(-n3[nH]c4ccccc4c3=O)c2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C32H31BrN6O4/c1-21(7-4-5-15-37-20-24(14-16-40)34-36-37)32(43)27-18-23(33)12-13-29(27)38(31(32)42)19-22-8-6-9-25(17-22)39-30(41)26-10-2-3-11-28(26)35-39/h2-4,6-13,17-18,20-21,35,40,43H,5,14-16,19H2,1H3/b7-4+/t21-,32+/m1/s1 |
| InChIKey | MPPPCZANJLWGOG-MTADLVJMSA-N |
| XLogP | 4.22 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|