C45H42N6O5 — CID 23985724
N-[(3R)-1-[(3-benzamidophenyl)methyl]-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-5-yl]benzamide (PubChem CID 23985724) has the molecular formula C45H42N6O5 and a molecular weight of 746.87 g/mol. Its IUPAC name is N-[(3R)-1-[(3-benzamidophenyl)methyl]-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-5-yl]benzamide.
| Compound Name | N-[(3R)-1-[(3-benzamidophenyl)methyl]-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 23985724 |
| Molecular Formula | C45H42N6O5 |
| Molecular Weight | 746.87 g/mol |
| Exact Mass | 746.32 |
| IUPAC Name | N-[(3R)-1-[(3-benzamidophenyl)methyl]-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-5-yl]benzamide |
| SMILES | C[C@@H](/C=C/CCn1cc(C(CO)c2ccccc2)nn1)[C@]1(O)C(=O)N(Cc2cccc(NC(=O)c3ccccc3)c2)c2ccc(NC(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C45H42N6O5/c1-31(14-11-12-25-50-29-40(48-49-50)38(30-52)33-16-5-2-6-17-33)45(56)39-27-37(47-43(54)35-20-9-4-10-21-35)23-24-41(39)51(44(45)55)28-32-15-13-22-36(26-32)46-42(53)34-18-7-3-8-19-34/h2-11,13-24,26-27,29,31,38,52,56H,12,25,28,30H2,1H3,(H,46,53)(H,47,54)/b14-11+/t31-,38?,45+/m0/s1 |
| InChIKey | OGKWANKTBBXPBB-KHLOIZQLSA-N |
| XLogP | 6.92 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.87 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|