C31H32N6O4 — CID 23817528
4-amino-N-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-1H-indol-5-yl]benzamide (PubChem CID 23817528) has the molecular formula C31H32N6O4 and a molecular weight of 552.64 g/mol. Its IUPAC name is 4-amino-N-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-1H-indol-5-yl]benzamide.
| Compound Name | 4-amino-N-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-1H-indol-5-yl]benzamide |
|---|---|
| PubChem CID | 23817528 |
| Molecular Formula | C31H32N6O4 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 4-amino-N-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-1H-indol-5-yl]benzamide |
| SMILES | C[C@@H](/C=C/CCn1cc(C(CO)c2ccccc2)nn1)[C@]1(O)C(=O)Nc2ccc(NC(=O)c3ccc(N)cc3)cc21 |
| InChI | InChI=1S/C31H32N6O4/c1-20(7-5-6-16-37-18-28(35-36-37)25(19-38)21-8-3-2-4-9-21)31(41)26-17-24(14-15-27(26)34-30(31)40)33-29(39)22-10-12-23(32)13-11-22/h2-5,7-15,17-18,20,25,38,41H,6,16,19,32H2,1H3,(H,33,39)(H,34,40)/b7-5+/t20-,25?,31+/m0/s1 |
| InChIKey | DYBPEVJBPHLKLA-RTHZPZTLSA-N |
| XLogP | 3.66 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|