C30H32N4O5 — CID 23788666
4-amino-N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-1H-indol-5-yl]benzamide (PubChem CID 23788666) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is 4-amino-N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-1H-indol-5-yl]benzamide.
| Compound Name | 4-amino-N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-1H-indol-5-yl]benzamide |
|---|---|
| PubChem CID | 23788666 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 4-amino-N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-1H-indol-5-yl]benzamide |
| SMILES | C[C@@H](/C=C/CC(=O)N(CCO)Cc1ccccc1)[C@]1(O)C(=O)Nc2ccc(NC(=O)c3ccc(N)cc3)cc21 |
| InChI | InChI=1S/C30H32N4O5/c1-20(6-5-9-27(36)34(16-17-35)19-21-7-3-2-4-8-21)30(39)25-18-24(14-15-26(25)33-29(30)38)32-28(37)22-10-12-23(31)13-11-22/h2-8,10-15,18,20,35,39H,9,16-17,19,31H2,1H3,(H,32,37)(H,33,38)/b6-5+/t20-,30+/m0/s1 |
| InChIKey | NNCGFLWNFWUKLJ-HVQHHPCFSA-N |
| XLogP | 3.26 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|