C23H25BrN2O4 — CID 23902001
(E,5R)-N-benzyl-5-[(3S)-5-bromo-3-hydroxy-2-oxo-1H-indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide (PubChem CID 23902001) has the molecular formula C23H25BrN2O4 and a molecular weight of 473.37 g/mol. Its IUPAC name is (E,5R)-N-benzyl-5-[(3S)-5-bromo-3-hydroxy-2-oxo-1H-indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide.
| Compound Name | (E,5R)-N-benzyl-5-[(3S)-5-bromo-3-hydroxy-2-oxo-1H-indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide |
|---|---|
| PubChem CID | 23902001 |
| Molecular Formula | C23H25BrN2O4 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (E,5R)-N-benzyl-5-[(3S)-5-bromo-3-hydroxy-2-oxo-1H-indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide |
| SMILES | C[C@H](/C=C/CC(=O)N(CCO)Cc1ccccc1)[C@@]1(O)C(=O)Nc2ccc(Br)cc21 |
| InChI | InChI=1S/C23H25BrN2O4/c1-16(23(30)19-14-18(24)10-11-20(19)25-22(23)29)6-5-9-21(28)26(12-13-27)15-17-7-3-2-4-8-17/h2-8,10-11,14,16,27,30H,9,12-13,15H2,1H3,(H,25,29)/b6-5+/t16-,23+/m1/s1 |
| InChIKey | IMFYZOXTKSRFJI-AHLNBCSKSA-N |
| XLogP | 3.19 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|