C31H30N4O5 — CID 23957838
(E,5R)-N-benzyl-N-(2-hydroxyethyl)-5-[(3S)-3-hydroxy-2-oxo-5-(1-oxophthalazin-2-yl)-1H-indol-3-yl]hex-3-enamide (PubChem CID 23957838) has the molecular formula C31H30N4O5 and a molecular weight of 538.60 g/mol. Its IUPAC name is (E,5R)-N-benzyl-N-(2-hydroxyethyl)-5-[(3S)-3-hydroxy-2-oxo-5-(1-oxophthalazin-2-yl)-1H-indol-3-yl]hex-3-enamide.
| Compound Name | (E,5R)-N-benzyl-N-(2-hydroxyethyl)-5-[(3S)-3-hydroxy-2-oxo-5-(1-oxophthalazin-2-yl)-1H-indol-3-yl]hex-3-enamide |
|---|---|
| PubChem CID | 23957838 |
| Molecular Formula | C31H30N4O5 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (E,5R)-N-benzyl-N-(2-hydroxyethyl)-5-[(3S)-3-hydroxy-2-oxo-5-(1-oxophthalazin-2-yl)-1H-indol-3-yl]hex-3-enamide |
| SMILES | C[C@H](/C=C/CC(=O)N(CCO)Cc1ccccc1)[C@@]1(O)C(=O)Nc2ccc(-n3ncc4ccccc4c3=O)cc21 |
| InChI | InChI=1S/C31H30N4O5/c1-21(8-7-13-28(37)34(16-17-36)20-22-9-3-2-4-10-22)31(40)26-18-24(14-15-27(26)33-30(31)39)35-29(38)25-12-6-5-11-23(25)19-32-35/h2-12,14-15,18-19,21,36,40H,13,16-17,20H2,1H3,(H,33,39)/b8-7+/t21-,31+/m1/s1 |
| InChIKey | SCEPNDVPSXWPBI-LFERRESMSA-N |
| XLogP | 3.13 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|