C32H33N3O5 — CID 23874166
(E,5R)-N-benzyl-N-(2-hydroxyethyl)-5-[(3S)-3-hydroxy-2-oxo-5-(2-oxo-3,4-dihydroquinolin-1-yl)-1H-indol-3-yl]hex-3-enamide (PubChem CID 23874166) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is (E,5R)-N-benzyl-N-(2-hydroxyethyl)-5-[(3S)-3-hydroxy-2-oxo-5-(2-oxo-3,4-dihydroquinolin-1-yl)-1H-indol-3-yl]hex-3-enamide.
| Compound Name | (E,5R)-N-benzyl-N-(2-hydroxyethyl)-5-[(3S)-3-hydroxy-2-oxo-5-(2-oxo-3,4-dihydroquinolin-1-yl)-1H-indol-3-yl]hex-3-enamide |
|---|---|
| PubChem CID | 23874166 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (E,5R)-N-benzyl-N-(2-hydroxyethyl)-5-[(3S)-3-hydroxy-2-oxo-5-(2-oxo-3,4-dihydroquinolin-1-yl)-1H-indol-3-yl]hex-3-enamide |
| SMILES | C[C@H](/C=C/CC(=O)N(CCO)Cc1ccccc1)[C@@]1(O)C(=O)Nc2ccc(N3C(=O)CCc4ccccc43)cc21 |
| InChI | InChI=1S/C32H33N3O5/c1-22(8-7-13-29(37)34(18-19-36)21-23-9-3-2-4-10-23)32(40)26-20-25(15-16-27(26)33-31(32)39)35-28-12-6-5-11-24(28)14-17-30(35)38/h2-12,15-16,20,22,36,40H,13-14,17-19,21H2,1H3,(H,33,39)/b8-7+/t22-,32+/m1/s1 |
| InChIKey | UFVICEZOHVNATF-ABWHESHSSA-N |
| XLogP | 4.04 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|