C38H46N4O7 — CID 23759773
(E,5R)-N-benzyl-5-[(3S)-5-[6-ethoxy-3-(4-hydroxybutylamino)-2-oxo-3,4-dihydroquinolin-1-yl]-3-hydroxy-2-oxo-1H-indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide (PubChem CID 23759773) has the molecular formula C38H46N4O7 and a molecular weight of 670.81 g/mol. Its IUPAC name is (E,5R)-N-benzyl-5-[(3S)-5-[6-ethoxy-3-(4-hydroxybutylamino)-2-oxo-3,4-dihydroquinolin-1-yl]-3-hydroxy-2-oxo-1H-indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide.
| Compound Name | (E,5R)-N-benzyl-5-[(3S)-5-[6-ethoxy-3-(4-hydroxybutylamino)-2-oxo-3,4-dihydroquinolin-1-yl]-3-hydroxy-2-oxo-1H-indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide |
|---|---|
| PubChem CID | 23759773 |
| Molecular Formula | C38H46N4O7 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | (E,5R)-N-benzyl-5-[(3S)-5-[6-ethoxy-3-(4-hydroxybutylamino)-2-oxo-3,4-dihydroquinolin-1-yl]-3-hydroxy-2-oxo-1H-indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide |
| SMILES | CCOc1ccc2c(c1)CC(NCCCCO)C(=O)N2c1ccc2c(c1)[C@@](O)([C@H](C)/C=C/CC(=O)N(CCO)Cc1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C38H46N4O7/c1-3-49-30-15-17-34-28(22-30)23-33(39-18-7-8-20-43)36(46)42(34)29-14-16-32-31(24-29)38(48,37(47)40-32)26(2)10-9-13-35(45)41(19-21-44)25-27-11-5-4-6-12-27/h4-6,9-12,14-17,22,24,26,33,39,43-44,48H,3,7-8,13,18-21,23,25H2,1-2H3,(H,40,47)/b10-9+/t26-,33?,38+/m1/s1 |
| InChIKey | YIRFYPYWEMOAGA-PQXKCBPESA-N |
| XLogP | 3.78 |
| TPSA | 151.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|