C32H30N6O4 — CID 23957755
2-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-1-phenylindol-5-yl]phthalazin-1-one (PubChem CID 23957755) has the molecular formula C32H30N6O4 and a molecular weight of 562.63 g/mol. Its IUPAC name is 2-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-1-phenylindol-5-yl]phthalazin-1-one.
| Compound Name | 2-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-1-phenylindol-5-yl]phthalazin-1-one |
|---|---|
| PubChem CID | 23957755 |
| Molecular Formula | C32H30N6O4 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 2-[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxo-1-phenylindol-5-yl]phthalazin-1-one |
| SMILES | C[C@@H](/C=C/CCn1cc(CCO)nn1)[C@]1(O)C(=O)N(c2ccccc2)c2ccc(-n3ncc4ccccc4c3=O)cc21 |
| InChI | InChI=1S/C32H30N6O4/c1-22(9-7-8-17-36-21-24(16-18-39)34-35-36)32(42)28-19-26(38-30(40)27-13-6-5-10-23(27)20-33-38)14-15-29(28)37(31(32)41)25-11-3-2-4-12-25/h2-7,9-15,19-22,39,42H,8,16-18H2,1H3/b9-7+/t22-,32+/m0/s1 |
| InChIKey | DMBXVHXQFLQVMK-GPKCROSOSA-N |
| XLogP | 3.66 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|