C35H37N5O4 — CID 23874160
(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopiperidin-1-yl)-1-phenylindol-2-one (PubChem CID 23874160) has the molecular formula C35H37N5O4 and a molecular weight of 591.71 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopiperidin-1-yl)-1-phenylindol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopiperidin-1-yl)-1-phenylindol-2-one |
|---|---|
| PubChem CID | 23874160 |
| Molecular Formula | C35H37N5O4 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopiperidin-1-yl)-1-phenylindol-2-one |
| SMILES | C[C@H](/C=C/CCn1cc(C(CO)c2ccccc2)nn1)[C@@]1(O)C(=O)N(c2ccccc2)c2ccc(N3CCCCC3=O)cc21 |
| InChI | InChI=1S/C35H37N5O4/c1-25(12-8-10-20-38-23-31(36-37-38)29(24-41)26-13-4-2-5-14-26)35(44)30-22-28(39-21-11-9-17-33(39)42)18-19-32(30)40(34(35)43)27-15-6-3-7-16-27/h2-8,12-16,18-19,22-23,25,29,41,44H,9-11,17,20-21,24H2,1H3/b12-8+/t25-,29?,35+/m1/s1 |
| InChIKey | USWZGMSGYCMCAM-TVXCNGSWSA-N |
| XLogP | 5.07 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|