C38H42N6O6 — CID 23930259
(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one (PubChem CID 23930259) has the molecular formula C38H42N6O6 and a molecular weight of 678.79 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one |
|---|---|
| PubChem CID | 23930259 |
| Molecular Formula | C38H42N6O6 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one |
| SMILES | C[C@H](/C=C/CCn1cc(C(CO)c2ccccc2)nn1)[C@@]1(O)C(=O)N(Cc2cccc(N3CCCCCCC3=O)c2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C38H42N6O6/c1-27(12-8-10-20-41-25-34(39-40-41)32(26-45)29-14-5-4-6-15-29)38(48)33-23-31(44(49)50)18-19-35(33)43(37(38)47)24-28-13-11-16-30(22-28)42-21-9-3-2-7-17-36(42)46/h4-6,8,11-16,18-19,22-23,25,27,32,45,48H,2-3,7,9-10,17,20-21,24,26H2,1H3/b12-8+/t27-,32?,38+/m1/s1 |
| InChIKey | CZLGZAXFGPRTMI-KDPPEGTHSA-N |
| XLogP | 5.62 |
| TPSA | 154.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|