C26H29N3O6 — CID 23930220
(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]indol-2-one (PubChem CID 23930220) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]indol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]indol-2-one |
|---|---|
| PubChem CID | 23930220 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]indol-2-one |
| SMILES | C[C@H](/C=C/CCO)[C@@]1(O)C(=O)N(Cc2cccc(N3CCCCC3=O)c2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C26H29N3O6/c1-18(7-3-5-14-30)26(33)22-16-21(29(34)35)11-12-23(22)28(25(26)32)17-19-8-6-9-20(15-19)27-13-4-2-10-24(27)31/h3,6-9,11-12,15-16,18,30,33H,2,4-5,10,13-14,17H2,1H3/b7-3+/t18-,26+/m1/s1 |
| InChIKey | TWFIFTXDVUBFFP-LJXFPHAESA-N |
| XLogP | 3.42 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|