C28H33N3O6 — CID 23874339
(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-1-[[4-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one (PubChem CID 23874339) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-1-[[4-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-1-[[4-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one |
|---|---|
| PubChem CID | 23874339 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | (3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-1-[[4-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one |
| SMILES | C[C@H](/C=C/CCO)[C@@]1(O)C(=O)N(Cc2ccc(N3CCCCCCC3=O)cc2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C28H33N3O6/c1-20(8-5-7-17-32)28(35)24-18-23(31(36)37)14-15-25(24)30(27(28)34)19-21-10-12-22(13-11-21)29-16-6-3-2-4-9-26(29)33/h5,8,10-15,18,20,32,35H,2-4,6-7,9,16-17,19H2,1H3/b8-5+/t20-,28+/m1/s1 |
| InChIKey | XBHBULPGYQXDLX-TXQZNOPVSA-N |
| XLogP | 4.20 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|