C27H32N4O6 — CID 23985876
N-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]piperidine-3-carboxamide (PubChem CID 23985876) has the molecular formula C27H32N4O6 and a molecular weight of 508.58 g/mol. Its IUPAC name is N-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]piperidine-3-carboxamide.
| Compound Name | N-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 23985876 |
| Molecular Formula | C27H32N4O6 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | N-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]piperidine-3-carboxamide |
| SMILES | C[C@H](/C=C/CCO)[C@@]1(O)C(=O)N(Cc2ccc(NC(=O)C3CCCNC3)cc2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C27H32N4O6/c1-18(5-2-3-14-32)27(35)23-15-22(31(36)37)11-12-24(23)30(26(27)34)17-19-7-9-21(10-8-19)29-25(33)20-6-4-13-28-16-20/h2,5,7-12,15,18,20,28,32,35H,3-4,6,13-14,16-17H2,1H3,(H,29,33)/b5-2+/t18-,20?,27+/m1/s1 |
| InChIKey | AUDNUOSDHMTYIZ-GSDYCNBMSA-N |
| XLogP | 2.84 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|