C30H35N7O6 — CID 23846310
(2R)-N-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 23846310) has the molecular formula C30H35N7O6 and a molecular weight of 589.65 g/mol. Its IUPAC name is (2R)-N-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23846310 |
| Molecular Formula | C30H35N7O6 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | (2R)-N-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | C[C@@H](/C=C/CCn1cc(CCO)nn1)[C@]1(O)C(=O)N(Cc2cccc(NC(=O)[C@H]3CCCN3)c2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C30H35N7O6/c1-20(6-2-3-14-35-19-23(12-15-38)33-34-35)30(41)25-17-24(37(42)43)10-11-27(25)36(29(30)40)18-21-7-4-8-22(16-21)32-28(39)26-9-5-13-31-26/h2,4,6-8,10-11,16-17,19-20,26,31,38,41H,3,5,9,12-15,18H2,1H3,(H,32,39)/b6-2+/t20-,26+,30+/m0/s1 |
| InChIKey | CZKREPHPPUQGJG-YLGMIWBISA-N |
| XLogP | 2.43 |
| TPSA | 175.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|