C35H35N7O6 — CID 23930230
(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-1-[[4-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)phenyl]methyl]indol-2-one (PubChem CID 23930230) has the molecular formula C35H35N7O6 and a molecular weight of 649.71 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-1-[[4-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)phenyl]methyl]indol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-1-[[4-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)phenyl]methyl]indol-2-one |
|---|---|
| PubChem CID | 23930230 |
| Molecular Formula | C35H35N7O6 |
| Molecular Weight | 649.71 g/mol |
| Exact Mass | 649.26 |
| IUPAC Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-1-[[4-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)phenyl]methyl]indol-2-one |
| SMILES | C[C@H](/C=C/CCn1cc(CCO)nn1)[C@@]1(O)C(=O)N(Cc2ccc(N3N=C(c4ccccc4)CCC3=O)cc2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C35H35N7O6/c1-24(7-5-6-19-39-23-27(18-20-43)36-38-39)35(46)30-21-29(42(47)48)14-16-32(30)40(34(35)45)22-25-10-12-28(13-11-25)41-33(44)17-15-31(37-41)26-8-3-2-4-9-26/h2-5,7-14,16,21,23-24,43,46H,6,15,17-20,22H2,1H3/b7-5+/t24-,35+/m1/s1 |
| InChIKey | YWUGGXBZWGYHFD-URYZJYGOSA-N |
| XLogP | 4.27 |
| TPSA | 167.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.71 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|