C25H26IN5O5 — CID 23902198
(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-1-[(4-iodophenyl)methyl]-5-nitroindol-2-one (PubChem CID 23902198) has the molecular formula C25H26IN5O5 and a molecular weight of 603.42 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-1-[(4-iodophenyl)methyl]-5-nitroindol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-1-[(4-iodophenyl)methyl]-5-nitroindol-2-one |
|---|---|
| PubChem CID | 23902198 |
| Molecular Formula | C25H26IN5O5 |
| Molecular Weight | 603.42 g/mol |
| Exact Mass | 603.10 |
| IUPAC Name | (3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-1-[(4-iodophenyl)methyl]-5-nitroindol-2-one |
| SMILES | C[C@H](/C=C/CCn1cc(CCO)nn1)[C@@]1(O)C(=O)N(Cc2ccc(I)cc2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C25H26IN5O5/c1-17(4-2-3-12-29-16-20(11-13-32)27-28-29)25(34)22-14-21(31(35)36)9-10-23(22)30(24(25)33)15-18-5-7-19(26)8-6-18/h2,4-10,14,16-17,32,34H,3,11-13,15H2,1H3/b4-2+/t17-,25+/m1/s1 |
| InChIKey | KVEDVCGCJZPGGD-WGVBEERESA-N |
| XLogP | 3.34 |
| TPSA | 134.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|