C28H27N3O6 — CID 23846386
N-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-N-phenylformamide (PubChem CID 23846386) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is N-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-N-phenylformamide.
| Compound Name | N-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-N-phenylformamide |
|---|---|
| PubChem CID | 23846386 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | N-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-N-phenylformamide |
| SMILES | C[C@H](/C=C/CCO)[C@@]1(O)C(=O)N(Cc2ccc(N(C=O)c3ccccc3)cc2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C28H27N3O6/c1-20(7-5-6-16-32)28(35)25-17-24(31(36)37)14-15-26(25)29(27(28)34)18-21-10-12-23(13-11-21)30(19-33)22-8-3-2-4-9-22/h2-5,7-15,17,19-20,32,35H,6,16,18H2,1H3/b7-5+/t20-,28+/m1/s1 |
| InChIKey | NOSOIPDMMOYTBU-FUPXWQDBSA-N |
| XLogP | 4.20 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|