C34H37N5O7 — CID 23874290
(E,5S)-N-benzyl-N-(2-hydroxyethyl)-5-[(3R)-3-hydroxy-5-nitro-2-oxo-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]indol-3-yl]hex-3-enamide (PubChem CID 23874290) has the molecular formula C34H37N5O7 and a molecular weight of 627.70 g/mol. Its IUPAC name is (E,5S)-N-benzyl-N-(2-hydroxyethyl)-5-[(3R)-3-hydroxy-5-nitro-2-oxo-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]indol-3-yl]hex-3-enamide.
| Compound Name | (E,5S)-N-benzyl-N-(2-hydroxyethyl)-5-[(3R)-3-hydroxy-5-nitro-2-oxo-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]indol-3-yl]hex-3-enamide |
|---|---|
| PubChem CID | 23874290 |
| Molecular Formula | C34H37N5O7 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | (E,5S)-N-benzyl-N-(2-hydroxyethyl)-5-[(3R)-3-hydroxy-5-nitro-2-oxo-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]indol-3-yl]hex-3-enamide |
| SMILES | C[C@@H](/C=C/CC(=O)N(CCO)Cc1ccccc1)[C@]1(O)C(=O)N(Cc2ccc(N3CCNCC3=O)cc2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C34H37N5O7/c1-24(6-5-9-31(41)36(18-19-40)22-25-7-3-2-4-8-25)34(44)29-20-28(39(45)46)14-15-30(29)38(33(34)43)23-26-10-12-27(13-11-26)37-17-16-35-21-32(37)42/h2-8,10-15,20,24,35,40,44H,9,16-19,21-23H2,1H3/b6-5+/t24-,34+/m0/s1 |
| InChIKey | GNEMMEKTUHCUBX-UIDPHMKLSA-N |
| XLogP | 2.87 |
| TPSA | 156.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|