C35H39N5O7 — CID 23930160
(2R)-N-[3-[[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-5-nitro-2-oxoindol-1-yl]methyl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 23930160) has the molecular formula C35H39N5O7 and a molecular weight of 641.73 g/mol. Its IUPAC name is (2R)-N-[3-[[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-5-nitro-2-oxoindol-1-yl]methyl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[3-[[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-5-nitro-2-oxoindol-1-yl]methyl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23930160 |
| Molecular Formula | C35H39N5O7 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | (2R)-N-[3-[[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-5-nitro-2-oxoindol-1-yl]methyl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | C[C@@H](/C=C/CC(=O)N(CCO)Cc1ccccc1)[C@]1(O)C(=O)N(Cc2cccc(NC(=O)[C@H]3CCCN3)c2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C35H39N5O7/c1-24(8-5-14-32(42)38(18-19-41)22-25-9-3-2-4-10-25)35(45)29-21-28(40(46)47)15-16-31(29)39(34(35)44)23-26-11-6-12-27(20-26)37-33(43)30-13-7-17-36-30/h2-6,8-12,15-16,20-21,24,30,36,41,45H,7,13-14,17-19,22-23H2,1H3,(H,37,43)/b8-5+/t24-,30+,35+/m0/s1 |
| InChIKey | BBJPSWQUSSJDRT-IPVDOKQSSA-N |
| XLogP | 3.62 |
| TPSA | 165.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|