C39H52N4O5 — CID 23759714
N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-2-oxoindol-5-yl]piperidine-3-carboxamide (PubChem CID 23759714) has the molecular formula C39H52N4O5 and a molecular weight of 656.87 g/mol. Its IUPAC name is N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-2-oxoindol-5-yl]piperidine-3-carboxamide.
| Compound Name | N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-2-oxoindol-5-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 23759714 |
| Molecular Formula | C39H52N4O5 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-2-oxoindol-5-yl]piperidine-3-carboxamide |
| SMILES | CC(C)=CCC/C(C)=C/CN1C(=O)[C@@](O)([C@@H](C)/C=C/CC(=O)N(CCO)Cc2ccccc2)c2cc(NC(=O)C3CCCNC3)ccc21 |
| InChI | InChI=1S/C39H52N4O5/c1-28(2)11-8-12-29(3)20-22-43-35-19-18-33(41-37(46)32-16-10-21-40-26-32)25-34(35)39(48,38(43)47)30(4)13-9-17-36(45)42(23-24-44)27-31-14-6-5-7-15-31/h5-7,9,11,13-15,18-20,25,30,32,40,44,48H,8,10,12,16-17,21-24,26-27H2,1-4H3,(H,41,46)/b13-9+,29-20+/t30-,32?,39+/m0/s1 |
| InChIKey | FTKOMMQAXLSSFP-VKBXXJDMSA-N |
| XLogP | 5.46 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|