C37H37N3O6 — CID 23817540
N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-1-phenylindol-5-yl]-4-methoxybenzamide (PubChem CID 23817540) has the molecular formula C37H37N3O6 and a molecular weight of 619.72 g/mol. Its IUPAC name is N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-1-phenylindol-5-yl]-4-methoxybenzamide.
| Compound Name | N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-1-phenylindol-5-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23817540 |
| Molecular Formula | C37H37N3O6 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | N-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-1-phenylindol-5-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)[C@](O)([C@@H](C)/C=C/CC(=O)N(CCO)Cc2ccccc2)C(=O)N3c2ccccc2)cc1 |
| InChI | InChI=1S/C37H37N3O6/c1-26(10-9-15-34(42)39(22-23-41)25-27-11-5-3-6-12-27)37(45)32-24-29(38-35(43)28-16-19-31(46-2)20-17-28)18-21-33(32)40(36(37)44)30-13-7-4-8-14-30/h3-14,16-21,24,26,41,45H,15,22-23,25H2,1-2H3,(H,38,43)/b10-9+/t26-,37+/m0/s1 |
| InChIKey | FDORHMDLYGSCJV-XXJILUKQSA-N |
| XLogP | 5.42 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|