C38H39N3O6 — CID 23985931
(E,5R)-N-benzyl-5-[(3S)-1-[[3-(N-formylanilino)phenyl]methyl]-3-hydroxy-5-methoxy-2-oxoindol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide (PubChem CID 23985931) has the molecular formula C38H39N3O6 and a molecular weight of 633.75 g/mol. Its IUPAC name is (E,5R)-N-benzyl-5-[(3S)-1-[[3-(N-formylanilino)phenyl]methyl]-3-hydroxy-5-methoxy-2-oxoindol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide.
| Compound Name | (E,5R)-N-benzyl-5-[(3S)-1-[[3-(N-formylanilino)phenyl]methyl]-3-hydroxy-5-methoxy-2-oxoindol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide |
|---|---|
| PubChem CID | 23985931 |
| Molecular Formula | C38H39N3O6 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | (E,5R)-N-benzyl-5-[(3S)-1-[[3-(N-formylanilino)phenyl]methyl]-3-hydroxy-5-methoxy-2-oxoindol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide |
| SMILES | COc1ccc2c(c1)[C@@](O)([C@H](C)/C=C/CC(=O)N(CCO)Cc1ccccc1)C(=O)N2Cc1cccc(N(C=O)c2ccccc2)c1 |
| InChI | InChI=1S/C38H39N3O6/c1-28(11-9-18-36(44)39(21-22-42)25-29-12-5-3-6-13-29)38(46)34-24-33(47-2)19-20-35(34)40(37(38)45)26-30-14-10-17-32(23-30)41(27-43)31-15-7-4-8-16-31/h3-17,19-20,23-24,27-28,42,46H,18,21-22,25-26H2,1-2H3/b11-9+/t28-,38+/m1/s1 |
| InChIKey | JTHIPVSCNHOYST-HVZNOSRDSA-N |
| XLogP | 5.33 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|