C37H35ClN4O5 — CID 23957967
(E,5S)-N-benzyl-5-[(3R)-5-chloro-3-hydroxy-2-oxo-1-[[3-(3-oxo-1H-indazol-2-yl)phenyl]methyl]indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide (PubChem CID 23957967) has the molecular formula C37H35ClN4O5 and a molecular weight of 651.16 g/mol. Its IUPAC name is (E,5S)-N-benzyl-5-[(3R)-5-chloro-3-hydroxy-2-oxo-1-[[3-(3-oxo-1H-indazol-2-yl)phenyl]methyl]indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide.
| Compound Name | (E,5S)-N-benzyl-5-[(3R)-5-chloro-3-hydroxy-2-oxo-1-[[3-(3-oxo-1H-indazol-2-yl)phenyl]methyl]indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide |
|---|---|
| PubChem CID | 23957967 |
| Molecular Formula | C37H35ClN4O5 |
| Molecular Weight | 651.16 g/mol |
| Exact Mass | 650.23 |
| IUPAC Name | (E,5S)-N-benzyl-5-[(3R)-5-chloro-3-hydroxy-2-oxo-1-[[3-(3-oxo-1H-indazol-2-yl)phenyl]methyl]indol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide |
| SMILES | C[C@@H](/C=C/CC(=O)N(CCO)Cc1ccccc1)[C@]1(O)C(=O)N(Cc2cccc(-n3[nH]c4ccccc4c3=O)c2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C37H35ClN4O5/c1-25(9-7-16-34(44)40(19-20-43)23-26-10-3-2-4-11-26)37(47)31-22-28(38)17-18-33(31)41(36(37)46)24-27-12-8-13-29(21-27)42-35(45)30-14-5-6-15-32(30)39-42/h2-15,17-18,21-22,25,39,43,47H,16,19-20,23-24H2,1H3/b9-7+/t25-,37+/m0/s1 |
| InChIKey | SXZZJYWTDJCNFS-FFSIFMRASA-N |
| XLogP | 5.31 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.16 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|