C40H41N3O7 — CID 23759711
methyl 5-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-5-(2-oxobenzo[cd]indol-1-yl)indol-1-yl]pentanoate (PubChem CID 23759711) has the molecular formula C40H41N3O7 and a molecular weight of 675.78 g/mol. Its IUPAC name is methyl 5-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-5-(2-oxobenzo[cd]indol-1-yl)indol-1-yl]pentanoate.
| Compound Name | methyl 5-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-5-(2-oxobenzo[cd]indol-1-yl)indol-1-yl]pentanoate |
|---|---|
| PubChem CID | 23759711 |
| Molecular Formula | C40H41N3O7 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.29 |
| IUPAC Name | methyl 5-[(3R)-3-[(E,2S)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxo-5-(2-oxobenzo[cd]indol-1-yl)indol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@@](O)([C@@H](C)/C=C/CC(=O)N(CCO)Cc2ccccc2)c2cc(N3C(=O)c4cccc5cccc3c45)ccc21 |
| InChI | InChI=1S/C40H41N3O7/c1-27(11-8-18-35(45)41(23-24-44)26-28-12-4-3-5-13-28)40(49)32-25-30(20-21-33(32)42(39(40)48)22-7-6-19-36(46)50-2)43-34-17-10-15-29-14-9-16-31(37(29)34)38(43)47/h3-5,8-17,20-21,25,27,44,49H,6-7,18-19,22-24,26H2,1-2H3/b11-8+/t27-,40+/m0/s1 |
| InChIKey | OWUITMOBIHJHIR-UURWDMRHSA-N |
| XLogP | 5.61 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|