C33H42N2O4 — CID 23985605
(E,5S)-N-benzyl-5-[(3R)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-2-oxoindol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide (PubChem CID 23985605) has the molecular formula C33H42N2O4 and a molecular weight of 530.71 g/mol. Its IUPAC name is (E,5S)-N-benzyl-5-[(3R)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-2-oxoindol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide.
| Compound Name | (E,5S)-N-benzyl-5-[(3R)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-2-oxoindol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide |
|---|---|
| PubChem CID | 23985605 |
| Molecular Formula | C33H42N2O4 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | (E,5S)-N-benzyl-5-[(3R)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-2-oxoindol-3-yl]-N-(2-hydroxyethyl)hex-3-enamide |
| SMILES | CC(C)=CCC/C(C)=C/CN1C(=O)[C@@](O)([C@@H](C)/C=C/CC(=O)N(CCO)Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C33H42N2O4/c1-25(2)12-10-13-26(3)20-21-35-30-18-9-8-17-29(30)33(39,32(35)38)27(4)14-11-19-31(37)34(22-23-36)24-28-15-6-5-7-16-28/h5-9,11-12,14-18,20,27,36,39H,10,13,19,21-24H2,1-4H3/b14-11+,26-20+/t27-,33+/m0/s1 |
| InChIKey | PKBRNQCBNVALTN-WCHLKIIXSA-N |
| XLogP | 5.52 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|