C34H41N3O9 — CID 23957841
methyl 5-[(3S)-5-(2-acetyloxy-4-oxoazetidin-1-yl)-3-[(E,2R)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxoindol-1-yl]pentanoate (PubChem CID 23957841) has the molecular formula C34H41N3O9 and a molecular weight of 635.71 g/mol. Its IUPAC name is methyl 5-[(3S)-5-(2-acetyloxy-4-oxoazetidin-1-yl)-3-[(E,2R)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxoindol-1-yl]pentanoate.
| Compound Name | methyl 5-[(3S)-5-(2-acetyloxy-4-oxoazetidin-1-yl)-3-[(E,2R)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxoindol-1-yl]pentanoate |
|---|---|
| PubChem CID | 23957841 |
| Molecular Formula | C34H41N3O9 |
| Molecular Weight | 635.71 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | methyl 5-[(3S)-5-(2-acetyloxy-4-oxoazetidin-1-yl)-3-[(E,2R)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-2-oxoindol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@](O)([C@H](C)/C=C/CC(=O)N(CCO)Cc2ccccc2)c2cc(N3C(=O)CC3OC(C)=O)ccc21 |
| InChI | InChI=1S/C34H41N3O9/c1-23(10-9-13-29(40)35(18-19-38)22-25-11-5-4-6-12-25)34(44)27-20-26(37-30(41)21-31(37)46-24(2)39)15-16-28(27)36(33(34)43)17-8-7-14-32(42)45-3/h4-6,9-12,15-16,20,23,31,38,44H,7-8,13-14,17-19,21-22H2,1-3H3/b10-9+/t23-,31?,34+/m1/s1 |
| InChIKey | MNBKAEQIDNTTNV-HYJVGUAOSA-N |
| XLogP | 2.79 |
| TPSA | 153.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.71 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|