C29H37N5O8 — CID 23901910
methyl 5-[(3R)-5-(2-acetyloxy-4-oxoazetidin-1-yl)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate (PubChem CID 23901910) has the molecular formula C29H37N5O8 and a molecular weight of 583.64 g/mol. Its IUPAC name is methyl 5-[(3R)-5-(2-acetyloxy-4-oxoazetidin-1-yl)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate.
| Compound Name | methyl 5-[(3R)-5-(2-acetyloxy-4-oxoazetidin-1-yl)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate |
|---|---|
| PubChem CID | 23901910 |
| Molecular Formula | C29H37N5O8 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | methyl 5-[(3R)-5-(2-acetyloxy-4-oxoazetidin-1-yl)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@@](O)([C@@H](C)/C=C/CCn2cc(CCO)nn2)c2cc(N3C(=O)CC3OC(C)=O)ccc21 |
| InChI | InChI=1S/C29H37N5O8/c1-19(8-4-6-13-32-18-21(12-15-35)30-31-32)29(40)23-16-22(34-25(37)17-26(34)42-20(2)36)10-11-24(23)33(28(29)39)14-7-5-9-27(38)41-3/h4,8,10-11,16,18-19,26,35,40H,5-7,9,12-15,17H2,1-3H3/b8-4+/t19-,26?,29+/m0/s1 |
| InChIKey | TWPHDUPVFJHFHC-KRVZHZJASA-N |
| XLogP | 1.60 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|