C36H41N5O7 — CID 23760015
N-[4-[[(3S)-3-[(E,2R)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-5-nitro-2-oxoindol-1-yl]methyl]phenyl]piperidine-3-carboxamide (PubChem CID 23760015) has the molecular formula C36H41N5O7 and a molecular weight of 655.75 g/mol. Its IUPAC name is N-[4-[[(3S)-3-[(E,2R)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-5-nitro-2-oxoindol-1-yl]methyl]phenyl]piperidine-3-carboxamide.
| Compound Name | N-[4-[[(3S)-3-[(E,2R)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-5-nitro-2-oxoindol-1-yl]methyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 23760015 |
| Molecular Formula | C36H41N5O7 |
| Molecular Weight | 655.75 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | N-[4-[[(3S)-3-[(E,2R)-6-[benzyl(2-hydroxyethyl)amino]-6-oxohex-3-en-2-yl]-3-hydroxy-5-nitro-2-oxoindol-1-yl]methyl]phenyl]piperidine-3-carboxamide |
| SMILES | C[C@H](/C=C/CC(=O)N(CCO)Cc1ccccc1)[C@@]1(O)C(=O)N(Cc2ccc(NC(=O)C3CCCNC3)cc2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C36H41N5O7/c1-25(7-5-11-33(43)39(19-20-42)23-26-8-3-2-4-9-26)36(46)31-21-30(41(47)48)16-17-32(31)40(35(36)45)24-27-12-14-29(15-13-27)38-34(44)28-10-6-18-37-22-28/h2-5,7-9,12-17,21,25,28,37,42,46H,6,10-11,18-20,22-24H2,1H3,(H,38,44)/b7-5+/t25-,28?,36+/m1/s1 |
| InChIKey | SITQLGQIHNHDNB-QSBURVEASA-N |
| XLogP | 3.87 |
| TPSA | 165.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.75 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|