C28H28N4O6 — CID 23846288
4-amino-N-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]benzamide (PubChem CID 23846288) has the molecular formula C28H28N4O6 and a molecular weight of 516.55 g/mol. Its IUPAC name is 4-amino-N-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]benzamide.
| Compound Name | 4-amino-N-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23846288 |
| Molecular Formula | C28H28N4O6 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 4-amino-N-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]benzamide |
| SMILES | C[C@@H](/C=C/CCO)[C@]1(O)C(=O)N(Cc2cccc(NC(=O)c3ccc(N)cc3)c2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C28H28N4O6/c1-18(5-2-3-14-33)28(36)24-16-23(32(37)38)12-13-25(24)31(27(28)35)17-19-6-4-7-22(15-19)30-26(34)20-8-10-21(29)11-9-20/h2,4-13,15-16,18,33,36H,3,14,17,29H2,1H3,(H,30,34)/b5-2+/t18-,28+/m0/s1 |
| InChIKey | LCYAKGCZYKPXHN-UXJGILTQSA-N |
| XLogP | 3.74 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|