C26H27N3O8 — CID 23985888
[1-[3-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate (PubChem CID 23985888) has the molecular formula C26H27N3O8 and a molecular weight of 509.52 g/mol. Its IUPAC name is [1-[3-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [1-[3-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 23985888 |
| Molecular Formula | C26H27N3O8 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | [1-[3-[[(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)OC1CC(=O)N1c1cccc(CN2C(=O)[C@](O)([C@H](C)/C=C/CCO)c3cc([N+](=O)[O-])ccc32)c1 |
| InChI | InChI=1S/C26H27N3O8/c1-16(6-3-4-11-30)26(34)21-13-20(29(35)36)9-10-22(21)27(25(26)33)15-18-7-5-8-19(12-18)28-23(32)14-24(28)37-17(2)31/h3,5-10,12-13,16,24,30,34H,4,11,14-15H2,1-2H3/b6-3+/t16-,24?,26+/m1/s1 |
| InChIKey | MMWNEIUCJACQIA-KRMPKSISSA-N |
| XLogP | 2.53 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|