C34H34N6O6 — CID 23846311
1-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-3,4-dihydroquinolin-2-one (PubChem CID 23846311) has the molecular formula C34H34N6O6 and a molecular weight of 622.68 g/mol. Its IUPAC name is 1-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 23846311 |
| Molecular Formula | C34H34N6O6 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | 1-[3-[[(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]-3,4-dihydroquinolin-2-one |
| SMILES | C[C@@H](/C=C/CCn1cc(CCO)nn1)[C@]1(O)C(=O)N(Cc2cccc(N3C(=O)CCc4ccccc43)c2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C34H34N6O6/c1-23(7-4-5-17-37-22-26(16-18-41)35-36-37)34(44)29-20-28(40(45)46)13-14-31(29)38(33(34)43)21-24-8-6-10-27(19-24)39-30-11-3-2-9-25(30)12-15-32(39)42/h2-4,6-11,13-14,19-20,22-23,41,44H,5,12,15-18,21H2,1H3/b7-4+/t23-,34+/m0/s1 |
| InChIKey | MVBXDUPLRKQUCV-BNEGHKMASA-N |
| XLogP | 4.35 |
| TPSA | 154.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|