C42H36N6O6 — CID 23958064
1-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]benzo[cd]indol-2-one (PubChem CID 23958064) has the molecular formula C42H36N6O6 and a molecular weight of 720.79 g/mol. Its IUPAC name is 1-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]benzo[cd]indol-2-one.
| Compound Name | 1-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]benzo[cd]indol-2-one |
|---|---|
| PubChem CID | 23958064 |
| Molecular Formula | C42H36N6O6 |
| Molecular Weight | 720.79 g/mol |
| Exact Mass | 720.27 |
| IUPAC Name | 1-[4-[[(3S)-3-hydroxy-3-[(E,2R)-6-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]hex-3-en-2-yl]-5-nitro-2-oxoindol-1-yl]methyl]phenyl]benzo[cd]indol-2-one |
| SMILES | C[C@H](/C=C/CCn1cc(C(CO)c2ccccc2)nn1)[C@@]1(O)C(=O)N(Cc2ccc(N3C(=O)c4cccc5cccc3c45)cc2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C42H36N6O6/c1-27(9-5-6-22-45-25-36(43-44-45)34(26-49)29-10-3-2-4-11-29)42(52)35-23-32(48(53)54)20-21-37(35)46(41(42)51)24-28-16-18-31(19-17-28)47-38-15-8-13-30-12-7-14-33(39(30)38)40(47)50/h2-5,7-21,23,25,27,34,49,52H,6,22,24,26H2,1H3/b9-5+/t27-,34?,42+/m1/s1 |
| InChIKey | RHGXGIYZLZUVSB-HCPYWPAFSA-N |
| XLogP | 6.77 |
| TPSA | 154.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.79 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|