C26H30N2O4 — CID 23788809
(3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]indol-2-one (PubChem CID 23788809) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]indol-2-one.
| Compound Name | (3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]indol-2-one |
|---|---|
| PubChem CID | 23788809 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]indol-2-one |
| SMILES | C[C@@H](/C=C/CCO)[C@]1(O)C(=O)N(Cc2cccc(N3CCCCC3=O)c2)c2ccccc21 |
| InChI | InChI=1S/C26H30N2O4/c1-19(9-5-7-16-29)26(32)22-12-2-3-13-23(22)28(25(26)31)18-20-10-8-11-21(17-20)27-15-6-4-14-24(27)30/h2-3,5,8-13,17,19,29,32H,4,6-7,14-16,18H2,1H3/b9-5+/t19-,26+/m0/s1 |
| InChIKey | BGJGDRWMMSXUGY-JEPUJXCGSA-N |
| XLogP | 3.51 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|