C25H27ClN2O4 — CID 23930215
(3S)-5-chloro-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-1-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]indol-2-one (PubChem CID 23930215) has the molecular formula C25H27ClN2O4 and a molecular weight of 454.95 g/mol. Its IUPAC name is (3S)-5-chloro-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-1-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]indol-2-one.
| Compound Name | (3S)-5-chloro-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-1-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]indol-2-one |
|---|---|
| PubChem CID | 23930215 |
| Molecular Formula | C25H27ClN2O4 |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (3S)-5-chloro-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-1-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]indol-2-one |
| SMILES | C[C@H](/C=C/CCO)[C@@]1(O)C(=O)N(Cc2cccc(N3CCCC3=O)c2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H27ClN2O4/c1-17(6-2-3-13-29)25(32)21-15-19(26)10-11-22(21)28(24(25)31)16-18-7-4-8-20(14-18)27-12-5-9-23(27)30/h2,4,6-8,10-11,14-15,17,29,32H,3,5,9,12-13,16H2,1H3/b6-2+/t17-,25+/m1/s1 |
| InChIKey | HRCYSXWKDYDPQW-BTPIVCKTSA-N |
| XLogP | 3.78 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|