C28H33BrN2O4 — CID 23902079
(3R)-5-bromo-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[[4-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one (PubChem CID 23902079) has the molecular formula C28H33BrN2O4 and a molecular weight of 541.49 g/mol. Its IUPAC name is (3R)-5-bromo-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[[4-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one.
| Compound Name | (3R)-5-bromo-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[[4-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one |
|---|---|
| PubChem CID | 23902079 |
| Molecular Formula | C28H33BrN2O4 |
| Molecular Weight | 541.49 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | (3R)-5-bromo-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[[4-(2-oxoazocan-1-yl)phenyl]methyl]indol-2-one |
| SMILES | C[C@@H](/C=C/CCO)[C@]1(O)C(=O)N(Cc2ccc(N3CCCCCCC3=O)cc2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C28H33BrN2O4/c1-20(8-5-7-17-32)28(35)24-18-22(29)12-15-25(24)31(27(28)34)19-21-10-13-23(14-11-21)30-16-6-3-2-4-9-26(30)33/h5,8,10-15,18,20,32,35H,2-4,6-7,9,16-17,19H2,1H3/b8-5+/t20-,28+/m0/s1 |
| InChIKey | NHJIIHYCRCNEEH-GPZVPHGXSA-N |
| XLogP | 5.06 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|