C21H22INO3 — CID 23985774
(3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one (PubChem CID 23985774) has the molecular formula C21H22INO3 and a molecular weight of 463.32 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one.
| Compound Name | (3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one |
|---|---|
| PubChem CID | 23985774 |
| Molecular Formula | C21H22INO3 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | (3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one |
| SMILES | C[C@@H](/C=C/CCO)[C@]1(O)C(=O)N(Cc2cccc(I)c2)c2ccccc21 |
| InChI | InChI=1S/C21H22INO3/c1-15(7-4-5-12-24)21(26)18-10-2-3-11-19(18)23(20(21)25)14-16-8-6-9-17(22)13-16/h2-4,6-11,13,15,24,26H,5,12,14H2,1H3/b7-4+/t15-,21+/m0/s1 |
| InChIKey | SEVDJJJUPFHZGS-NZKJCNSLSA-N |
| XLogP | 3.60 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|