C27H28N2O5 — CID 23902178
(3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-1-[[4-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]indol-2-one (PubChem CID 23902178) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-1-[[4-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]indol-2-one.
| Compound Name | (3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-1-[[4-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]indol-2-one |
|---|---|
| PubChem CID | 23902178 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (3S)-3-hydroxy-3-[(E,2R)-6-hydroxyhex-3-en-2-yl]-1-[[4-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]indol-2-one |
| SMILES | COc1cccn(-c2ccc(CN3C(=O)[C@](O)([C@H](C)/C=C/CCO)c4ccccc43)cc2)c1=O |
| InChI | InChI=1S/C27H28N2O5/c1-19(8-5-6-17-30)27(33)22-9-3-4-10-23(22)29(26(27)32)18-20-12-14-21(15-13-20)28-16-7-11-24(34-2)25(28)31/h3-5,7-16,19,30,33H,6,17-18H2,1-2H3/b8-5+/t19-,27+/m1/s1 |
| InChIKey | ZVOPULZVPXPZGI-KBDCJRQMSA-N |
| XLogP | 3.16 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|