C31H31N3O4 — CID 23985764
N-[4-[[(3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-2-oxoindol-1-yl]methyl]phenyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 23985764) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is N-[4-[[(3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-2-oxoindol-1-yl]methyl]phenyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[4-[[(3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-2-oxoindol-1-yl]methyl]phenyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 23985764 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | N-[4-[[(3R)-3-hydroxy-3-[(E,2S)-6-hydroxyhex-3-en-2-yl]-2-oxoindol-1-yl]methyl]phenyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | C[C@@H](/C=C/CCO)[C@]1(O)C(=O)N(Cc2ccc(NC(=O)Cc3c[nH]c4ccccc34)cc2)c2ccccc21 |
| InChI | InChI=1S/C31H31N3O4/c1-21(8-6-7-17-35)31(38)26-10-3-5-12-28(26)34(30(31)37)20-22-13-15-24(16-14-22)33-29(36)18-23-19-32-27-11-4-2-9-25(23)27/h2-6,8-16,19,21,32,35,38H,7,17-18,20H2,1H3,(H,33,36)/b8-6+/t21-,31+/m0/s1 |
| InChIKey | WYIAMVOBPXWNSP-GKIAEJLASA-N |
| XLogP | 4.66 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|