C26H29IN2O4 — CID 23985862
(3R)-3-hydroxy-3-[(E,2S)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one (PubChem CID 23985862) has the molecular formula C26H29IN2O4 and a molecular weight of 560.43 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-[(E,2S)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one.
| Compound Name | (3R)-3-hydroxy-3-[(E,2S)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one |
|---|---|
| PubChem CID | 23985862 |
| Molecular Formula | C26H29IN2O4 |
| Molecular Weight | 560.43 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | (3R)-3-hydroxy-3-[(E,2S)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-1-[(3-iodophenyl)methyl]indol-2-one |
| SMILES | C[C@@H](/C=C/CC(=O)N1CCC[C@H]1CO)[C@]1(O)C(=O)N(Cc2cccc(I)c2)c2ccccc21 |
| InChI | InChI=1S/C26H29IN2O4/c1-18(7-4-13-24(31)28-14-6-10-21(28)17-30)26(33)22-11-2-3-12-23(22)29(25(26)32)16-19-8-5-9-20(27)15-19/h2-5,7-9,11-12,15,18,21,30,33H,6,10,13-14,16-17H2,1H3/b7-4+/t18-,21-,26+/m0/s1 |
| InChIKey | BQTQUWYNDASQED-NLKWLRAHSA-N |
| XLogP | 3.59 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|