C22H27IN2O4 — CID 23930001
(3R)-3-hydroxy-3-[(E,2S)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-5-iodo-1-prop-2-enylindol-2-one (PubChem CID 23930001) has the molecular formula C22H27IN2O4 and a molecular weight of 510.37 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-[(E,2S)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-5-iodo-1-prop-2-enylindol-2-one.
| Compound Name | (3R)-3-hydroxy-3-[(E,2S)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-5-iodo-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 23930001 |
| Molecular Formula | C22H27IN2O4 |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | (3R)-3-hydroxy-3-[(E,2S)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-5-iodo-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)[C@@](O)([C@@H](C)/C=C/CC(=O)N2CCC[C@H]2CO)c2cc(I)ccc21 |
| InChI | InChI=1S/C22H27IN2O4/c1-3-11-25-19-10-9-16(23)13-18(19)22(29,21(25)28)15(2)6-4-8-20(27)24-12-5-7-17(24)14-26/h3-4,6,9-10,13,15,17,26,29H,1,5,7-8,11-12,14H2,2H3/b6-4+/t15-,17-,22+/m0/s1 |
| InChIKey | YHEAJCSBGVFIAK-KGQCHHKESA-N |
| XLogP | 2.58 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|